use crate::{ config::{CrateConfig, ExecutableType}, error::{Error, Result}, tools::Tool, DioxusConfig, }; use cargo_metadata::{diagnostic::Diagnostic, Message}; use indicatif::{ProgressBar, ProgressStyle}; use serde::Serialize; use std::{ fs::{copy, create_dir_all, File}, io::Read, panic, path::PathBuf, process::Command, time::Duration, }; use wasm_bindgen_cli_support::Bindgen; #[derive(Serialize, Debug, Clone)] pub struct BuildResult { pub warnings: Vec, pub elapsed_time: u128, } pub fn build(config: &CrateConfig, quiet: bool) -> Result { // [1] Build the project with cargo, generating a wasm32-unknown-unknown target (is there a more specific, better target to leverage?) // [2] Generate the appropriate build folders // [3] Wasm-bindgen the .wasm fiile, and move it into the {builddir}/modules/xxxx/xxxx_bg.wasm // [4] Wasm-opt the .wasm file with whatever optimizations need to be done // [5][OPTIONAL] Builds the Tailwind CSS file using the Tailwind standalone binary // [6] Link up the html page to the wasm module let CrateConfig { out_dir, crate_dir, target_dir, asset_dir, executable, dioxus_config, .. } = config; // start to build the assets let ignore_files = build_assets(config)?; let t_start = std::time::Instant::now(); // [1] Build the .wasm module log::info!("🚅 Running build command..."); let cmd = subprocess::Exec::cmd("cargo"); let cmd = cmd .cwd(&crate_dir) .arg("build") .arg("--target") .arg("wasm32-unknown-unknown") .arg("--message-format=json"); let cmd = if config.release { cmd.arg("--release") } else { cmd }; let cmd = if config.verbose { cmd.arg("--verbose") } else { cmd }; let cmd = if quiet { cmd.arg("--quiet") } else { cmd }; let cmd = if config.custom_profile.is_some() { let custom_profile = config.custom_profile.as_ref().unwrap(); cmd.arg("--profile").arg(custom_profile) } else { cmd }; let cmd = if config.features.is_some() { let features_str = config.features.as_ref().unwrap().join(" "); cmd.arg("--features").arg(features_str) } else { cmd }; let cmd = match executable { ExecutableType::Binary(name) => cmd.arg("--bin").arg(name), ExecutableType::Lib(name) => cmd.arg("--lib").arg(name), ExecutableType::Example(name) => cmd.arg("--example").arg(name), }; let warning_messages = prettier_build(cmd)?; // [2] Establish the output directory structure let bindgen_outdir = out_dir.join("assets").join("dioxus"); let release_type = match config.release { true => "release", false => "debug", }; let input_path = match executable { ExecutableType::Binary(name) | ExecutableType::Lib(name) => target_dir .join(format!("wasm32-unknown-unknown/{}", release_type)) .join(format!("{}.wasm", name)), ExecutableType::Example(name) => target_dir .join(format!("wasm32-unknown-unknown/{}/examples", release_type)) .join(format!("{}.wasm", name)), }; let bindgen_result = panic::catch_unwind(move || { // [3] Bindgen the final binary for use easy linking let mut bindgen_builder = Bindgen::new(); bindgen_builder .input_path(input_path) .web(true) .unwrap() .debug(true) .demangle(true) .keep_debug(true) .remove_name_section(false) .remove_producers_section(false) .out_name(&dioxus_config.application.name) .generate(&bindgen_outdir) .unwrap(); }); if bindgen_result.is_err() { return Err(Error::BuildFailed("Bindgen build failed! \nThis is probably due to the Bindgen version, dioxus-cli using `0.2.81` Bindgen crate.".to_string())); } // check binaryen:wasm-opt tool let dioxus_tools = dioxus_config.application.tools.clone().unwrap_or_default(); if dioxus_tools.contains_key("binaryen") { let info = dioxus_tools.get("binaryen").unwrap(); let binaryen = crate::tools::Tool::Binaryen; if binaryen.is_installed() { if let Some(sub) = info.as_table() { if sub.contains_key("wasm_opt") && sub.get("wasm_opt").unwrap().as_bool().unwrap_or(false) { log::info!("Optimizing WASM size with wasm-opt..."); let target_file = out_dir .join("assets") .join("dioxus") .join(format!("{}_bg.wasm", dioxus_config.application.name)); if target_file.is_file() { let mut args = vec![ target_file.to_str().unwrap(), "-o", target_file.to_str().unwrap(), ]; if config.release == true { args.push("-Oz"); } binaryen.call("wasm-opt", args)?; } } } } else { log::warn!( "Binaryen tool not found, you can use `dioxus tool add binaryen` to install it." ); } } // [5][OPTIONAL] If tailwind is enabled and installed we run it to generate the CSS if dioxus_tools.contains_key("tailwindcss") { let info = dioxus_tools.get("tailwindcss").unwrap(); let tailwind = crate::tools::Tool::Tailwind; if tailwind.is_installed() { if let Some(sub) = info.as_table() { log::info!("Building Tailwind bundle CSS file..."); let input_path = match sub.get("input") { Some(val) => val.as_str().unwrap(), None => "./public", }; let config_path = match sub.get("config") { Some(val) => val.as_str().unwrap(), None => "./src/tailwind.config.js", }; let mut args = vec![ "-i", input_path, "-o", "dist/tailwind.css", "-c", config_path, ]; if config.release == true { args.push("--minify"); } tailwind.call("tailwindcss", args)?; } } else { log::warn!( "Tailwind tool not found, you can use `dioxus tool add tailwindcss` to install it." ); } } // this code will copy all public file to the output dir let copy_options = fs_extra::dir::CopyOptions { overwrite: true, skip_exist: false, buffer_size: 64000, copy_inside: false, content_only: false, depth: 0, }; if asset_dir.is_dir() { for entry in std::fs::read_dir(&asset_dir)? { let path = entry?.path(); if path.is_file() { std::fs::copy(&path, out_dir.join(path.file_name().unwrap()))?; } else { match fs_extra::dir::copy(&path, out_dir, ©_options) { Ok(_) => {} Err(_e) => { log::warn!("Error copying dir: {}", _e); } } for ignore in &ignore_files { let ignore = ignore.strip_prefix(&config.asset_dir).unwrap(); let ignore = config.out_dir.join(ignore); if ignore.is_file() { std::fs::remove_file(ignore)?; } } } } } let t_end = std::time::Instant::now(); Ok(BuildResult { warnings: warning_messages, elapsed_time: (t_end - t_start).as_millis(), }) } pub fn build_desktop(config: &CrateConfig, _is_serve: bool) -> Result<()> { log::info!("🚅 Running build [Desktop] command..."); let ignore_files = build_assets(config)?; let mut cmd = Command::new("cargo"); cmd.current_dir(&config.crate_dir) .arg("build") .stdout(std::process::Stdio::inherit()) .stderr(std::process::Stdio::inherit()); if config.release { cmd.arg("--release"); } if config.verbose { cmd.arg("--verbose"); } if config.custom_profile.is_some() { let custom_profile = config.custom_profile.as_ref().unwrap(); cmd.arg("--profile"); cmd.arg(custom_profile); } if config.features.is_some() { let features_str = config.features.as_ref().unwrap().join(" "); cmd.arg("--features"); cmd.arg(features_str); } match &config.executable { crate::ExecutableType::Binary(name) => cmd.arg("--bin").arg(name), crate::ExecutableType::Lib(name) => cmd.arg("--lib").arg(name), crate::ExecutableType::Example(name) => cmd.arg("--example").arg(name), }; let output = cmd.output()?; if !output.status.success() { return Err(Error::BuildFailed("Program build failed.".into())); } if output.status.success() { let release_type = match config.release { true => "release", false => "debug", }; let file_name: String; let mut res_path = match &config.executable { crate::ExecutableType::Binary(name) | crate::ExecutableType::Lib(name) => { file_name = name.clone(); config.target_dir.join(release_type).join(name) } crate::ExecutableType::Example(name) => { file_name = name.clone(); config .target_dir .join(release_type) .join("examples") .join(name) } }; let target_file = if cfg!(windows) { res_path.set_extension("exe"); format!("{}.exe", &file_name) } else { file_name }; if !config.out_dir.is_dir() { create_dir_all(&config.out_dir)?; } copy(res_path, &config.out_dir.join(target_file))?; // this code will copy all public file to the output dir if config.asset_dir.is_dir() { let copy_options = fs_extra::dir::CopyOptions { overwrite: true, skip_exist: false, buffer_size: 64000, copy_inside: false, content_only: false, depth: 0, }; for entry in std::fs::read_dir(&config.asset_dir)? { let path = entry?.path(); if path.is_file() { std::fs::copy(&path, &config.out_dir.join(path.file_name().unwrap()))?; } else { match fs_extra::dir::copy(&path, &config.out_dir, ©_options) { Ok(_) => {} Err(e) => { log::warn!("Error copying dir: {}", e); } } for ignore in &ignore_files { let ignore = ignore.strip_prefix(&config.asset_dir).unwrap(); let ignore = config.out_dir.join(ignore); if ignore.is_file() { std::fs::remove_file(ignore)?; } } } } } log::info!( "🚩 Build completed: [./{}]", config .dioxus_config .application .out_dir .clone() .unwrap_or_else(|| PathBuf::from("dist")) .display() ); } Ok(()) } fn prettier_build(cmd: subprocess::Exec) -> anyhow::Result> { let mut warning_messages: Vec = vec![]; let pb = ProgressBar::new_spinner(); pb.enable_steady_tick(Duration::from_millis(200)); pb.set_style( ProgressStyle::with_template("{spinner:.dim.bold} {wide_msg}") .unwrap() .tick_chars("/|\\- "), ); pb.set_message("💼 Waiting to start build the project..."); struct StopSpinOnDrop(ProgressBar); impl Drop for StopSpinOnDrop { fn drop(&mut self) { self.0.finish_and_clear(); } } StopSpinOnDrop(pb.clone()); let stdout = cmd.detached().stream_stdout()?; let reader = std::io::BufReader::new(stdout); for message in cargo_metadata::Message::parse_stream(reader) { match message.unwrap() { Message::CompilerMessage(msg) => { let message = msg.message; match message.level { cargo_metadata::diagnostic::DiagnosticLevel::Error => { return { Err(anyhow::anyhow!(message .rendered .unwrap_or("Unknown".into()))) }; } cargo_metadata::diagnostic::DiagnosticLevel::Warning => { warning_messages.push(message.clone()); } _ => {} } } Message::CompilerArtifact(artifact) => { pb.set_message(format!("Compiling {} ", artifact.package_id)); pb.tick(); } Message::BuildScriptExecuted(script) => { let _package_id = script.package_id.to_string(); } Message::BuildFinished(finished) => { if finished.success { log::info!("👑 Build done."); } else { std::process::exit(1); } } _ => (), // Unknown message } } Ok(warning_messages) } pub fn gen_page(config: &DioxusConfig, serve: bool) -> String { let crate_root = crate::cargo::crate_root().unwrap(); let custom_html_file = crate_root.join("index.html"); let mut html = if custom_html_file.is_file() { let mut buf = String::new(); let mut file = File::open(custom_html_file).unwrap(); if file.read_to_string(&mut buf).is_ok() { buf } else { String::from(include_str!("./assets/index.html")) } } else { String::from(include_str!("./assets/index.html")) }; let resouces = config.web.resource.clone(); let mut style_list = resouces.style.unwrap_or_default(); let mut script_list = resouces.script.unwrap_or_default(); if serve { let mut dev_style = resouces.dev.style.clone().unwrap_or_default(); let mut dev_script = resouces.dev.script.unwrap_or_default(); style_list.append(&mut dev_style); script_list.append(&mut dev_script); } let mut style_str = String::new(); for style in style_list { style_str.push_str(&format!( "\n", &style.to_str().unwrap(), )) } if config .application .tools .clone() .unwrap_or_default() .contains_key("tailwindcss") { style_str.push_str("\n"); } replace_or_insert_before("{style_include}", &style_str, "\n", &script.to_str().unwrap(), )) } replace_or_insert_before("{script_include}", &script_str, "{}", include_str!("./assets/autoreload.js") ); } let base_path = match &config.web.app.base_path { Some(path) => path, None => ".", }; let app_name = &config.application.name; // Check if a script already exists if html.contains("{app_name}") && html.contains("{base_path}") { html = html.replace("{app_name}", app_name); html = html.replace("{base_path}", base_path); } else { // If not, insert the script html = html.replace( " import init from "/{base_path}/assets/dioxus/{app_name}.js"; init("/{base_path}/assets/dioxus/{app_name}_bg.wasm").then(wasm => {{ if (wasm.__wbindgen_start == undefined) {{ wasm.main(); }} }}); Result> { let mut result = vec![]; let dioxus_config = &config.dioxus_config; let dioxus_tools = dioxus_config.application.tools.clone().unwrap_or_default(); // check sass tool state let sass = Tool::Sass; if sass.is_installed() && dioxus_tools.contains_key("sass") { let sass_conf = dioxus_tools.get("sass").unwrap(); if let Some(tab) = sass_conf.as_table() { let source_map = tab.contains_key("source_map"); let source_map = if source_map && tab.get("source_map").unwrap().is_bool() { if tab.get("source_map").unwrap().as_bool().unwrap_or_default() { "--source-map" } else { "--no-source-map" } } else { "--source-map" }; if tab.contains_key("input") { if tab.get("input").unwrap().is_str() { let file = tab.get("input").unwrap().as_str().unwrap().trim(); if file == "*" { // if the sass open auto, we need auto-check the assets dir. let asset_dir = config.asset_dir.clone(); if asset_dir.is_dir() { for entry in walkdir::WalkDir::new(&asset_dir) .into_iter() .filter_map(|e| e.ok()) { let temp = entry.path(); if temp.is_file() { let suffix = temp.extension(); if suffix.is_none() { continue; } let suffix = suffix.unwrap().to_str().unwrap(); if suffix == "scss" || suffix == "sass" { // if file suffix is `scss` / `sass` we need transform it. let out_file = format!( "{}.css", temp.file_stem().unwrap().to_str().unwrap() ); let target_path = config .out_dir .join( temp.strip_prefix(&asset_dir) .unwrap() .parent() .unwrap(), ) .join(out_file); let res = sass.call( "sass", vec![ temp.to_str().unwrap(), target_path.to_str().unwrap(), source_map, ], ); if res.is_ok() { result.push(temp.to_path_buf()); } } } } } } else { // just transform one file. let relative_path = if &file[0..1] == "/" { &file[1..file.len()] } else { file }; let path = config.asset_dir.join(relative_path); let out_file = format!("{}.css", path.file_stem().unwrap().to_str().unwrap()); let target_path = config .out_dir .join(PathBuf::from(relative_path).parent().unwrap()) .join(out_file); if path.is_file() { let res = sass.call( "sass", vec![ path.to_str().unwrap(), target_path.to_str().unwrap(), source_map, ], ); if res.is_ok() { result.push(path); } else { log::error!("{:?}", res); } } } } else if tab.get("input").unwrap().is_array() { // check files list. let list = tab.get("input").unwrap().as_array().unwrap(); for i in list { if i.is_str() { let path = i.as_str().unwrap(); let relative_path = if &path[0..1] == "/" { &path[1..path.len()] } else { path }; let path = config.asset_dir.join(relative_path); let out_file = format!("{}.css", path.file_stem().unwrap().to_str().unwrap()); let target_path = config .out_dir .join(PathBuf::from(relative_path).parent().unwrap()) .join(out_file); if path.is_file() { let res = sass.call( "sass", vec![ path.to_str().unwrap(), target_path.to_str().unwrap(), source_map, ], ); if res.is_ok() { result.push(path); } } } } } } } } // SASS END Ok(result) } // use binary_install::{Cache, Download}; // /// Attempts to find `wasm-opt` in `PATH` locally, or failing that downloads a // /// precompiled binary. // /// // /// Returns `Some` if a binary was found or it was successfully downloaded. // /// Returns `None` if a binary wasn't found in `PATH` and this platform doesn't // /// have precompiled binaries. Returns an error if we failed to download the // /// binary. // pub fn find_wasm_opt( // cache: &Cache, // install_permitted: bool, // ) -> Result { // // First attempt to look up in PATH. If found assume it works. // if let Ok(path) = which::which("wasm-opt") { // PBAR.info(&format!("found wasm-opt at {:?}", path)); // match path.as_path().parent() { // Some(path) => return Ok(install::Status::Found(Download::at(path))), // None => {} // } // } // let version = "version_78"; // Ok(install::download_prebuilt( // &install::Tool::WasmOpt, // cache, // version, // install_permitted, // )?) // }